C27H35N3O5 — CID 54657585
2-[(3S,6aS,8R,10aS)-3-hydroxy-1-[(3-pyridin-4-ylphenyl)methyl]-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-1-morpholin-4-ylethanone (PubChem CID 54657585) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is 2-[(3S,6aS,8R,10aS)-3-hydroxy-1-[(3-pyridin-4-ylphenyl)methyl]-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(3S,6aS,8R,10aS)-3-hydroxy-1-[(3-pyridin-4-ylphenyl)methyl]-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 54657585 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 2-[(3S,6aS,8R,10aS)-3-hydroxy-1-[(3-pyridin-4-ylphenyl)methyl]-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-1-morpholin-4-ylethanone |
| SMILES | O=C(C[C@H]1CC[C@H]2[C@@H](COC[C@@H](O)CN2Cc2cccc(-c3ccncc3)c2)O1)N1CCOCC1 |
| InChI | InChI=1S/C27H35N3O5/c31-23-17-30(16-20-2-1-3-22(14-20)21-6-8-28-9-7-21)25-5-4-24(35-26(25)19-34-18-23)15-27(32)29-10-12-33-13-11-29/h1-3,6-9,14,23-26,31H,4-5,10-13,15-19H2/t23-,24+,25-,26+/m0/s1 |
| InChIKey | VMOCTUISBGPURH-ROXDYWFKSA-N |
| XLogP | 2.11 |
| TPSA | 84.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |