C25H32N4O3 — CID 54662367
(2R,3R,3aS,9bS)-N-(cyclohexylmethyl)-3-(hydroxymethyl)-6-oxo-1-(pyridin-2-ylmethyl)-3,3a,4,9b-tetrahydro-2H-pyrrolo[2,3-a]indolizine-2-carboxamide (PubChem CID 54662367) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is (2R,3R,3aS,9bS)-N-(cyclohexylmethyl)-3-(hydroxymethyl)-6-oxo-1-(pyridin-2-ylmethyl)-3,3a,4,9b-tetrahydro-2H-pyrrolo[2,3-a]indolizine-2-carboxamide.
| Compound Name | (2R,3R,3aS,9bS)-N-(cyclohexylmethyl)-3-(hydroxymethyl)-6-oxo-1-(pyridin-2-ylmethyl)-3,3a,4,9b-tetrahydro-2H-pyrrolo[2,3-a]indolizine-2-carboxamide |
|---|---|
| PubChem CID | 54662367 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (2R,3R,3aS,9bS)-N-(cyclohexylmethyl)-3-(hydroxymethyl)-6-oxo-1-(pyridin-2-ylmethyl)-3,3a,4,9b-tetrahydro-2H-pyrrolo[2,3-a]indolizine-2-carboxamide |
| SMILES | O=C(NCC1CCCCC1)[C@H]1[C@H](CO)[C@H]2Cn3c(cccc3=O)[C@H]2N1Cc1ccccn1 |
| InChI | InChI=1S/C25H32N4O3/c30-16-20-19-15-28-21(10-6-11-22(28)31)23(19)29(14-18-9-4-5-12-26-18)24(20)25(32)27-13-17-7-2-1-3-8-17/h4-6,9-12,17,19-20,23-24,30H,1-3,7-8,13-16H2,(H,27,32)/t19-,20-,23+,24-/m1/s1 |
| InChIKey | ZKBRAEFVRXSBDJ-MYSJAJEPSA-N |
| XLogP | 2.10 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |