C25H31N3O4 — CID 54663265
(1R,9S,10S,11S)-10-(hydroxymethyl)-5-(4-methoxyphenyl)-12-methyl-11-(piperidine-1-carbonyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one (PubChem CID 54663265) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is (1R,9S,10S,11S)-10-(hydroxymethyl)-5-(4-methoxyphenyl)-12-methyl-11-(piperidine-1-carbonyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one.
| Compound Name | (1R,9S,10S,11S)-10-(hydroxymethyl)-5-(4-methoxyphenyl)-12-methyl-11-(piperidine-1-carbonyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one |
|---|---|
| PubChem CID | 54663265 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | (1R,9S,10S,11S)-10-(hydroxymethyl)-5-(4-methoxyphenyl)-12-methyl-11-(piperidine-1-carbonyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one |
| SMILES | COc1ccc(-c2ccc3n(c2=O)C[C@@H]2[C@@H](CO)[C@H](C(=O)N4CCCCC4)[C@H]3N2C)cc1 |
| InChI | InChI=1S/C25H31N3O4/c1-26-21-14-28-20(11-10-18(24(28)30)16-6-8-17(32-2)9-7-16)23(26)22(19(21)15-29)25(31)27-12-4-3-5-13-27/h6-11,19,21-23,29H,3-5,12-15H2,1-2H3/t19-,21-,22+,23+/m1/s1 |
| InChIKey | DNUBDPZRJPBUDI-LGKPFJOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |