C24H27FN2O — CID 54667243
[(8R,9R,10S)-9-[4-[2-(2-fluorophenyl)ethynyl]phenyl]-6-methyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol (PubChem CID 54667243) has the molecular formula C24H27FN2O and a molecular weight of 378.49 g/mol. Its IUPAC name is [(8R,9R,10S)-9-[4-[2-(2-fluorophenyl)ethynyl]phenyl]-6-methyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol.
| Compound Name | [(8R,9R,10S)-9-[4-[2-(2-fluorophenyl)ethynyl]phenyl]-6-methyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
|---|---|
| PubChem CID | 54667243 |
| Molecular Formula | C24H27FN2O |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | [(8R,9R,10S)-9-[4-[2-(2-fluorophenyl)ethynyl]phenyl]-6-methyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
| SMILES | CN1CCCCN2[C@H](CO)[C@H](c3ccc(C#Cc4ccccc4F)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C24H27FN2O/c1-26-14-4-5-15-27-22(16-26)24(23(27)17-28)20-12-9-18(10-13-20)8-11-19-6-2-3-7-21(19)25/h2-3,6-7,9-10,12-13,22-24,28H,4-5,14-17H2,1H3/t22-,23+,24+/m0/s1 |
| InChIKey | XOKMPFCSEYGAFJ-RBZQAINGSA-N |
| XLogP | 3.08 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|