C27H31F3N2O2 — CID 54666898
[(8R,9R,10R)-9-[4-[2-(2-methoxyphenyl)ethynyl]phenyl]-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol (PubChem CID 54666898) has the molecular formula C27H31F3N2O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is [(8R,9R,10R)-9-[4-[2-(2-methoxyphenyl)ethynyl]phenyl]-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol.
| Compound Name | [(8R,9R,10R)-9-[4-[2-(2-methoxyphenyl)ethynyl]phenyl]-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
|---|---|
| PubChem CID | 54666898 |
| Molecular Formula | C27H31F3N2O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | [(8R,9R,10R)-9-[4-[2-(2-methoxyphenyl)ethynyl]phenyl]-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
| SMILES | COc1ccccc1C#Cc1ccc([C@H]2[C@H](CO)N3CCCCN(CCC(F)(F)F)C[C@@H]23)cc1 |
| InChI | InChI=1S/C27H31F3N2O2/c1-34-25-7-3-2-6-21(25)11-8-20-9-12-22(13-10-20)26-23-18-31(17-14-27(28,29)30)15-4-5-16-32(23)24(26)19-33/h2-3,6-7,9-10,12-13,23-24,26,33H,4-5,14-19H2,1H3/t23-,24-,26+/m0/s1 |
| InChIKey | QKINXIGIIZMJGG-KYPHJKQUSA-N |
| XLogP | 4.27 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|