C23H29F3N2O — CID 54669412
[(8R,9S,10R)-9-[4-(2-cyclopropylethynyl)phenyl]-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol (PubChem CID 54669412) has the molecular formula C23H29F3N2O and a molecular weight of 406.49 g/mol. Its IUPAC name is [(8R,9S,10R)-9-[4-(2-cyclopropylethynyl)phenyl]-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol.
| Compound Name | [(8R,9S,10R)-9-[4-(2-cyclopropylethynyl)phenyl]-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
|---|---|
| PubChem CID | 54669412 |
| Molecular Formula | C23H29F3N2O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | [(8R,9S,10R)-9-[4-(2-cyclopropylethynyl)phenyl]-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
| SMILES | OC[C@H]1[C@@H](c2ccc(C#CC3CC3)cc2)[C@@H]2CN(CCC(F)(F)F)CCCCN12 |
| InChI | InChI=1S/C23H29F3N2O/c24-23(25,26)11-14-27-12-1-2-13-28-20(15-27)22(21(28)16-29)19-9-7-18(8-10-19)6-5-17-3-4-17/h7-10,17,20-22,29H,1-4,11-16H2/t20-,21-,22-/m0/s1 |
| InChIKey | XIISTGTUQJHGNI-FKBYEOEOSA-N |
| XLogP | 3.62 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|