C27H34F3N3O2 — CID 54668988
3-[4-[(8S,9R,10S)-10-(hydroxymethyl)-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-9-yl]phenyl]-N,N-dimethylbenzamide (PubChem CID 54668988) has the molecular formula C27H34F3N3O2 and a molecular weight of 489.58 g/mol. Its IUPAC name is 3-[4-[(8S,9R,10S)-10-(hydroxymethyl)-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-9-yl]phenyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[4-[(8S,9R,10S)-10-(hydroxymethyl)-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-9-yl]phenyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 54668988 |
| Molecular Formula | C27H34F3N3O2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 3-[4-[(8S,9R,10S)-10-(hydroxymethyl)-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-9-yl]phenyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(-c2ccc([C@H]3[C@@H](CO)N4CCCCN(CCC(F)(F)F)C[C@H]34)cc2)c1 |
| InChI | InChI=1S/C27H34F3N3O2/c1-31(2)26(35)22-7-5-6-21(16-22)19-8-10-20(11-9-19)25-23-17-32(15-12-27(28,29)30)13-3-4-14-33(23)24(25)18-34/h5-11,16,23-25,34H,3-4,12-15,17-18H2,1-2H3/t23-,24-,25-/m1/s1 |
| InChIKey | SUWVCNKGBWKVIR-UBFVSLLYSA-N |
| XLogP | 4.23 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |