C27H32N2O4S — CID 54667806
[(8S,9R,10S)-9-[4-(2-cyclopropylethynyl)phenyl]-6-(3-methoxyphenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol (PubChem CID 54667806) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is [(8S,9R,10S)-9-[4-(2-cyclopropylethynyl)phenyl]-6-(3-methoxyphenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol.
| Compound Name | [(8S,9R,10S)-9-[4-(2-cyclopropylethynyl)phenyl]-6-(3-methoxyphenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
|---|---|
| PubChem CID | 54667806 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | [(8S,9R,10S)-9-[4-(2-cyclopropylethynyl)phenyl]-6-(3-methoxyphenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
| SMILES | COc1cccc(S(=O)(=O)N2CCCCN3[C@H](CO)[C@H](c4ccc(C#CC5CC5)cc4)[C@H]3C2)c1 |
| InChI | InChI=1S/C27H32N2O4S/c1-33-23-5-4-6-24(17-23)34(31,32)28-15-2-3-16-29-25(18-28)27(26(29)19-30)22-13-11-21(12-14-22)10-9-20-7-8-20/h4-6,11-14,17,20,25-27,30H,2-3,7-8,15-16,18-19H2,1H3/t25-,26-,27-/m1/s1 |
| InChIKey | VRVIXNHSJAFXRW-ZONZVBGPSA-N |
| XLogP | 3.07 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|