C27H34N2O4S — CID 54669178
[(8S,9R,10R)-6-(3-methoxyphenyl)sulfonyl-9-[4-(3-methylbut-1-ynyl)phenyl]-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol (PubChem CID 54669178) has the molecular formula C27H34N2O4S and a molecular weight of 482.65 g/mol. Its IUPAC name is [(8S,9R,10R)-6-(3-methoxyphenyl)sulfonyl-9-[4-(3-methylbut-1-ynyl)phenyl]-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol.
| Compound Name | [(8S,9R,10R)-6-(3-methoxyphenyl)sulfonyl-9-[4-(3-methylbut-1-ynyl)phenyl]-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
|---|---|
| PubChem CID | 54669178 |
| Molecular Formula | C27H34N2O4S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | [(8S,9R,10R)-6-(3-methoxyphenyl)sulfonyl-9-[4-(3-methylbut-1-ynyl)phenyl]-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
| SMILES | COc1cccc(S(=O)(=O)N2CCCCN3[C@H](C2)[C@@H](c2ccc(C#CC(C)C)cc2)[C@@H]3CO)c1 |
| InChI | InChI=1S/C27H34N2O4S/c1-20(2)9-10-21-11-13-22(14-12-21)27-25-18-28(15-4-5-16-29(25)26(27)19-30)34(31,32)24-8-6-7-23(17-24)33-3/h6-8,11-14,17,20,25-27,30H,4-5,15-16,18-19H2,1-3H3/t25-,26+,27-/m1/s1 |
| InChIKey | PAGPGUZNPYMQQZ-KWXIBIRDSA-N |
| XLogP | 3.32 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|