C22H32N2O3S — CID 54668737
[(8R,9R,10S)-6-ethylsulfonyl-9-(4-pent-1-ynylphenyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol (PubChem CID 54668737) has the molecular formula C22H32N2O3S and a molecular weight of 404.58 g/mol. Its IUPAC name is [(8R,9R,10S)-6-ethylsulfonyl-9-(4-pent-1-ynylphenyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol.
| Compound Name | [(8R,9R,10S)-6-ethylsulfonyl-9-(4-pent-1-ynylphenyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
|---|---|
| PubChem CID | 54668737 |
| Molecular Formula | C22H32N2O3S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | [(8R,9R,10S)-6-ethylsulfonyl-9-(4-pent-1-ynylphenyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
| SMILES | CCCC#Cc1ccc([C@H]2[C@@H](CO)N3CCCCN(S(=O)(=O)CC)C[C@@H]23)cc1 |
| InChI | InChI=1S/C22H32N2O3S/c1-3-5-6-9-18-10-12-19(13-11-18)22-20-16-23(28(26,27)4-2)14-7-8-15-24(20)21(22)17-25/h10-13,20-22,25H,3-5,7-8,14-17H2,1-2H3/t20-,21+,22+/m0/s1 |
| InChIKey | GVOYMLQVSFTQRJ-BHDDXSALSA-N |
| XLogP | 2.41 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|