C27H34N2O3S — CID 54666877
[(8R,9R,10R)-6-benzylsulfonyl-9-(4-pent-1-ynylphenyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol (PubChem CID 54666877) has the molecular formula C27H34N2O3S and a molecular weight of 466.65 g/mol. Its IUPAC name is [(8R,9R,10R)-6-benzylsulfonyl-9-(4-pent-1-ynylphenyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol.
| Compound Name | [(8R,9R,10R)-6-benzylsulfonyl-9-(4-pent-1-ynylphenyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
|---|---|
| PubChem CID | 54666877 |
| Molecular Formula | C27H34N2O3S |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | [(8R,9R,10R)-6-benzylsulfonyl-9-(4-pent-1-ynylphenyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
| SMILES | CCCC#Cc1ccc([C@H]2[C@H](CO)N3CCCCN(S(=O)(=O)Cc4ccccc4)C[C@@H]23)cc1 |
| InChI | InChI=1S/C27H34N2O3S/c1-2-3-5-10-22-13-15-24(16-14-22)27-25-19-28(17-8-9-18-29(25)26(27)20-30)33(31,32)21-23-11-6-4-7-12-23/h4,6-7,11-16,25-27,30H,2-3,8-9,17-21H2,1H3/t25-,26-,27+/m0/s1 |
| InChIKey | QBGGOYIGHSRUMN-GMQQYTKMSA-N |
| XLogP | 3.59 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|