C22H26N6O — CID 54671147
[1-[3-[(1-quinolin-2-ylazetidin-3-yl)amino]pyrazin-2-yl]piperidin-4-yl]methanol (PubChem CID 54671147) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is [1-[3-[(1-quinolin-2-ylazetidin-3-yl)amino]pyrazin-2-yl]piperidin-4-yl]methanol.
| Compound Name | [1-[3-[(1-quinolin-2-ylazetidin-3-yl)amino]pyrazin-2-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 54671147 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [1-[3-[(1-quinolin-2-ylazetidin-3-yl)amino]pyrazin-2-yl]piperidin-4-yl]methanol |
| SMILES | OCC1CCN(c2nccnc2NC2CN(c3ccc4ccccc4n3)C2)CC1 |
| InChI | InChI=1S/C22H26N6O/c29-15-16-7-11-27(12-8-16)22-21(23-9-10-24-22)25-18-13-28(14-18)20-6-5-17-3-1-2-4-19(17)26-20/h1-6,9-10,16,18,29H,7-8,11-15H2,(H,23,25) |
| InChIKey | ARTLREOXVDAJBM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |