About 2-(2-oxopropyl)-4,5,6,7-tetrahydro-1-benzofuran-3-one
2-(2-oxopropyl)-4,5,6,7-tetrahydro-1-benzofuran-3-one (PubChem CID 54671484) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-(2-oxopropyl)-4,5,6,7-tetrahydro-1-benzofuran-3-one.
Analyze 2-(2-oxopropyl)-4,5,6,7-tetrahydro-1-benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxopropyl)-4,5,6,7-tetrahydro-1-benzofuran-3-one?
The IUPAC name of 2-(2-oxopropyl)-4,5,6,7-tetrahydro-1-benzofuran-3-one (CID 54671484) is 2-(2-oxopropyl)-4,5,6,7-tetrahydro-1-benzofuran-3-one.
What is the SMILES notation for 2-(2-oxopropyl)-4,5,6,7-tetrahydro-1-benzofuran-3-one?
The canonical SMILES for 2-(2-oxopropyl)-4,5,6,7-tetrahydro-1-benzofuran-3-one is CC(=O)CC1OC2=C(CCCC2)C1=O.
What is the InChIKey of 2-(2-oxopropyl)-4,5,6,7-tetrahydro-1-benzofuran-3-one?
The InChIKey is OUBXKSPBWUWPPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-7(12)6-10-11(13)8-4-2-3-5-9(8)14-10/h10H,2-6H2,1H3.
What are the key properties of 2-(2-oxopropyl)-4,5,6,7-tetrahydro-1-benzofuran-3-one?
2-(2-oxopropyl)-4,5,6,7-tetrahydro-1-benzofuran-3-one has a molecular weight of 194.23 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxopropyl)-4,5,6,7-tetrahydro-1-benzofuran-3-one is sourced from PubChem (CID 54671484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).