C16H24O5 — CID 162894370
6-hydroxy-2-(1-hydroxy-6-oxoheptyl)-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 162894370) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 6-hydroxy-2-(1-hydroxy-6-oxoheptyl)-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | 6-hydroxy-2-(1-hydroxy-6-oxoheptyl)-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 162894370 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 6-hydroxy-2-(1-hydroxy-6-oxoheptyl)-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | CC(=O)CCCCC(O)C1CCC2=C(CCC(O)C2=O)O1 |
| InChI | InChI=1S/C16H24O5/c1-10(17)4-2-3-5-12(18)15-8-6-11-14(21-15)9-7-13(19)16(11)20/h12-13,15,18-19H,2-9H2,1H3 |
| InChIKey | JXHGVDMSZCJROO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|