C16H24O3 — CID 122372541
(2S,5S)-5-hydroxy-2-[(E)-oct-1-enyl]-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one (PubChem CID 122372541) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (2S,5S)-5-hydroxy-2-[(E)-oct-1-enyl]-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one.
| Compound Name | (2S,5S)-5-hydroxy-2-[(E)-oct-1-enyl]-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one |
|---|---|
| PubChem CID | 122372541 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2S,5S)-5-hydroxy-2-[(E)-oct-1-enyl]-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one |
| SMILES | CCCCCC/C=C/[C@@H]1CC2=C(CC[C@H](O)C2=O)O1 |
| InChI | InChI=1S/C16H24O3/c1-2-3-4-5-6-7-8-12-11-13-15(19-12)10-9-14(17)16(13)18/h7-8,12,14,17H,2-6,9-11H2,1H3/b8-7+/t12-,14+/m1/s1 |
| InChIKey | BUOPNNJIMAZXHO-KHAURHHGSA-N |
| XLogP | 3.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|