C16H24O4 — CID 24777078
(2S,6S)-2-heptanoyl-6-hydroxy-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 24777078) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (2S,6S)-2-heptanoyl-6-hydroxy-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | (2S,6S)-2-heptanoyl-6-hydroxy-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 24777078 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (2S,6S)-2-heptanoyl-6-hydroxy-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | CCCCCCC(=O)[C@@H]1CCC2=C(CC[C@H](O)C2=O)O1 |
| InChI | InChI=1S/C16H24O4/c1-2-3-4-5-6-12(17)15-9-7-11-14(20-15)10-8-13(18)16(11)19/h13,15,18H,2-10H2,1H3/t13-,15-/m0/s1 |
| InChIKey | LGADEQBKEQFPDQ-ZFWWWQNUSA-N |
| XLogP | 2.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|