C16H24O5 — CID 156582513
(2S,3R,3aR,7R,8bR)-2-hexyl-3,7-dihydroxy-3,3a,5,6,7,8b-hexahydro-2H-furo[3,2-b][1]benzofuran-8-one (PubChem CID 156582513) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is (2S,3R,3aR,7R,8bR)-2-hexyl-3,7-dihydroxy-3,3a,5,6,7,8b-hexahydro-2H-furo[3,2-b][1]benzofuran-8-one.
| Compound Name | (2S,3R,3aR,7R,8bR)-2-hexyl-3,7-dihydroxy-3,3a,5,6,7,8b-hexahydro-2H-furo[3,2-b][1]benzofuran-8-one |
|---|---|
| PubChem CID | 156582513 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (2S,3R,3aR,7R,8bR)-2-hexyl-3,7-dihydroxy-3,3a,5,6,7,8b-hexahydro-2H-furo[3,2-b][1]benzofuran-8-one |
| SMILES | CCCCCC[C@@H]1O[C@@H]2C3=C(CC[C@@H](O)C3=O)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C16H24O5/c1-2-3-4-5-6-11-14(19)16-15(21-11)12-10(20-16)8-7-9(17)13(12)18/h9,11,14-17,19H,2-8H2,1H3/t9-,11+,14-,15-,16-/m1/s1 |
| InChIKey | PDGBDTHQTORUCD-XDDVRUDJSA-N |
| XLogP | 1.46 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|