C18H28O5 — CID 51693805
[(1S)-1-[(2S,8R)-8-hydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptyl] acetate (PubChem CID 51693805) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is [(1S)-1-[(2S,8R)-8-hydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptyl] acetate.
| Compound Name | [(1S)-1-[(2S,8R)-8-hydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptyl] acetate |
|---|---|
| PubChem CID | 51693805 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | [(1S)-1-[(2S,8R)-8-hydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptyl] acetate |
| SMILES | CCCCCC[C@H](OC(C)=O)[C@@H]1CCC2=C(O1)[C@H](O)CCC2=O |
| InChI | InChI=1S/C18H28O5/c1-3-4-5-6-7-16(22-12(2)19)17-11-8-13-14(20)9-10-15(21)18(13)23-17/h15-17,21H,3-11H2,1-2H3/t15-,16+,17+/m1/s1 |
| InChIKey | SFLFFEIPNRVHIL-IKGGRYGDSA-N |
| XLogP | 3.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|