C18H28O6 — CID 11046077
[(1S)-1-[(2S,4R,8R)-4,8-dihydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptyl] acetate (PubChem CID 11046077) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is [(1S)-1-[(2S,4R,8R)-4,8-dihydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptyl] acetate.
| Compound Name | [(1S)-1-[(2S,4R,8R)-4,8-dihydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptyl] acetate |
|---|---|
| PubChem CID | 11046077 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [(1S)-1-[(2S,4R,8R)-4,8-dihydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptyl] acetate |
| SMILES | CCCCCC[C@H](OC(C)=O)[C@@H]1C[C@@H](O)C2=C(O1)[C@H](O)CCC2=O |
| InChI | InChI=1S/C18H28O6/c1-3-4-5-6-7-15(23-11(2)19)16-10-14(22)17-12(20)8-9-13(21)18(17)24-16/h13-16,21-22H,3-10H2,1-2H3/t13-,14-,15+,16+/m1/s1 |
| InChIKey | IQJNEUHAOSRWQP-WCVJEAGWSA-N |
| XLogP | 2.02 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|