C21H37NO5S — CID 88833645
methyl 7-[2-[(1S)-1-acetyloxyoctyl]-4-oxo-1,3-thiazolidin-3-yl]heptanoate (PubChem CID 88833645) has the molecular formula C21H37NO5S and a molecular weight of 415.60 g/mol. Its IUPAC name is methyl 7-[2-[(1S)-1-acetyloxyoctyl]-4-oxo-1,3-thiazolidin-3-yl]heptanoate.
| Compound Name | methyl 7-[2-[(1S)-1-acetyloxyoctyl]-4-oxo-1,3-thiazolidin-3-yl]heptanoate |
|---|---|
| PubChem CID | 88833645 |
| Molecular Formula | C21H37NO5S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | methyl 7-[2-[(1S)-1-acetyloxyoctyl]-4-oxo-1,3-thiazolidin-3-yl]heptanoate |
| SMILES | CCCCCCC[C@H](OC(C)=O)C1SCC(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C21H37NO5S/c1-4-5-6-7-10-13-18(27-17(2)23)21-22(19(24)16-28-21)15-12-9-8-11-14-20(25)26-3/h18,21H,4-16H2,1-3H3/t18-,21?/m0/s1 |
| InChIKey | YVALVYLATHUTLJ-YMXDCFFPSA-N |
| XLogP | 4.30 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|