About ethanol;2-hydroxy-2-oxoethaneperoxoate
ethanol;2-hydroxy-2-oxoethaneperoxoate (PubChem CID 54675793) has the molecular formula C4H7O6-
and a molecular weight of 151.09 g/mol. Its IUPAC name is ethanol;2-hydroxy-2-oxoethaneperoxoate.
Molecular Properties
| Compound Name | ethanol;2-hydroxy-2-oxoethaneperoxoate |
| PubChem CID | 54675793 |
| Molecular Formula | C4H7O6- |
| Molecular Weight | 151.09 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | ethanol;2-hydroxy-2-oxoethaneperoxoate |
| SMILES | CCO.O=C(O)C(=O)O[O-] |
| InChI | InChI=1S/C2H2O5.C2H6O/c3-1(4)2(5)7-6;1-2-3/h6H,(H,3,4);3H,2H2,1H3/p-1 |
| InChIKey | IEPDEYVIULLKQK-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.09 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethanol;2-hydroxy-2-oxoethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-hydroxy-2-oxoethaneperoxoate?
The IUPAC name of ethanol;2-hydroxy-2-oxoethaneperoxoate (CID 54675793) is ethanol;2-hydroxy-2-oxoethaneperoxoate.
What is the SMILES notation for ethanol;2-hydroxy-2-oxoethaneperoxoate?
The canonical SMILES for ethanol;2-hydroxy-2-oxoethaneperoxoate is CCO.O=C(O)C(=O)O[O-].
What is the InChIKey of ethanol;2-hydroxy-2-oxoethaneperoxoate?
The InChIKey is IEPDEYVIULLKQK-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H2O5.C2H6O/c3-1(4)2(5)7-6;1-2-3/h6H,(H,3,4);3H,2H2,1H3/p-1.
What are the key properties of ethanol;2-hydroxy-2-oxoethaneperoxoate?
ethanol;2-hydroxy-2-oxoethaneperoxoate has a molecular weight of 151.09 g/mol, XLogP of -2.11, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-hydroxy-2-oxoethaneperoxoate is sourced from PubChem (CID 54675793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).