C20H14N3O3S+ — CID 54676570
7-hydroxy-4-(4-methoxyphenyl)-5-oxo-2-phenylthieno[3,2-b]pyridine-6-diazonium (PubChem CID 54676570) has the molecular formula C20H14N3O3S+ and a molecular weight of 376.42 g/mol. Its IUPAC name is 7-hydroxy-4-(4-methoxyphenyl)-5-oxo-2-phenylthieno[3,2-b]pyridine-6-diazonium.
| Compound Name | 7-hydroxy-4-(4-methoxyphenyl)-5-oxo-2-phenylthieno[3,2-b]pyridine-6-diazonium |
|---|---|
| PubChem CID | 54676570 |
| Molecular Formula | C20H14N3O3S+ |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 7-hydroxy-4-(4-methoxyphenyl)-5-oxo-2-phenylthieno[3,2-b]pyridine-6-diazonium |
| SMILES | COc1ccc(-n2c(=O)c([N+]#N)c(O)c3sc(-c4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C20H13N3O3S/c1-26-14-9-7-13(8-10-14)23-15-11-16(12-5-3-2-4-6-12)27-19(15)18(24)17(22-21)20(23)25/h2-11H,1H3/p+1 |
| InChIKey | HBYMTHXFHXIKKP-UHFFFAOYSA-O |
| XLogP | 4.92 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|