C25H20ClN5O4 — CID 5467759
N-[(Z)-3-[2-(5-chloro-6-oxo-1H-pyridazin-4-yl)-2-methylhydrazinyl]-1-(2-hydroxynaphthalen-1-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 5467759) has the molecular formula C25H20ClN5O4 and a molecular weight of 489.92 g/mol. Its IUPAC name is N-[(Z)-3-[2-(5-chloro-6-oxo-1H-pyridazin-4-yl)-2-methylhydrazinyl]-1-(2-hydroxynaphthalen-1-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[2-(5-chloro-6-oxo-1H-pyridazin-4-yl)-2-methylhydrazinyl]-1-(2-hydroxynaphthalen-1-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 5467759 |
| Molecular Formula | C25H20ClN5O4 |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | N-[(Z)-3-[2-(5-chloro-6-oxo-1H-pyridazin-4-yl)-2-methylhydrazinyl]-1-(2-hydroxynaphthalen-1-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CN(NC(=O)/C(=C/c1c(O)ccc2ccccc12)NC(=O)c1ccccc1)c1cn[nH]c(=O)c1Cl |
| InChI | InChI=1S/C25H20ClN5O4/c1-31(20-14-27-29-25(35)22(20)26)30-24(34)19(28-23(33)16-8-3-2-4-9-16)13-18-17-10-6-5-7-15(17)11-12-21(18)32/h2-14,32H,1H3,(H,28,33)(H,29,35)(H,30,34)/b19-13- |
| InChIKey | HGIHULDGPSXPEJ-UYRXBGFRSA-N |
| XLogP | 3.22 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|