C28H26N2O2 — CID 6184528
N-[(E)-1-anthracen-9-yl-3-(diethylamino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 6184528) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[(E)-1-anthracen-9-yl-3-(diethylamino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-anthracen-9-yl-3-(diethylamino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 6184528 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[(E)-1-anthracen-9-yl-3-(diethylamino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCN(CC)C(=O)/C(=C\c1c2ccccc2cc2ccccc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H26N2O2/c1-3-30(4-2)28(32)26(29-27(31)20-12-6-5-7-13-20)19-25-23-16-10-8-14-21(23)18-22-15-9-11-17-24(22)25/h5-19H,3-4H2,1-2H3,(H,29,31)/b26-19+ |
| InChIKey | YUOWZAGKCWODJH-LGUFXXKBSA-N |
| XLogP | 5.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|