C14H15NO4 — CID 54677973
Ethyl 1-benzyl-3-hydroxy-2(5H)-oxopyrrole-4-carboxylate (PubChem CID 54677973) has the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. Its IUPAC name is ethyl 1-benzyl-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | Ethyl 1-benzyl-3-hydroxy-2(5H)-oxopyrrole-4-carboxylate |
|---|---|
| PubChem CID | 54677973 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | ethyl 1-benzyl-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)N(C1)CC2=CC=CC=C2)O |
| InChI | InChI=1S/C14H15NO4/c1-2-19-14(18)11-9-15(13(17)12(11)16)8-10-6-4-3-5-7-10/h3-7,16H,2,8-9H2,1H3 |
| InChIKey | IGYRPDIWSYGHMY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | 396 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |