C14H14BrNO4 — CID 54737677
ethyl 1-[(4-bromophenyl)methyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 54737677) has the molecular formula C14H14BrNO4 and a molecular weight of 340.17 g/mol. Its IUPAC name is ethyl 1-[(4-bromophenyl)methyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | ethyl 1-[(4-bromophenyl)methyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 54737677 |
| Molecular Formula | C14H14BrNO4 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | ethyl 1-[(4-bromophenyl)methyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=O)N(Cc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C14H14BrNO4/c1-2-20-14(19)11-8-16(13(18)12(11)17)7-9-3-5-10(15)6-4-9/h3-6,17H,2,7-8H2,1H3 |
| InChIKey | TXJZMRCYLQHSHU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |