C18H13N3O4S2 — CID 5467830
5-[[(5E)-5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 5467830) has the molecular formula C18H13N3O4S2 and a molecular weight of 399.45 g/mol. Its IUPAC name is 5-[[(5E)-5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[(5E)-5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5467830 |
| Molecular Formula | C18H13N3O4S2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 5-[[(5E)-5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(=Cc1ccccc1)/C=C1/SC(=S)N(C=C2C(=O)NC(=O)NC2=O)C1=O |
| InChI | InChI=1S/C18H13N3O4S2/c1-10(7-11-5-3-2-4-6-11)8-13-16(24)21(18(26)27-13)9-12-14(22)19-17(25)20-15(12)23/h2-9H,1H3,(H2,19,20,22,23,25)/b10-7?,13-8+ |
| InChIKey | OSEJWEDHCMQAEQ-NVCCEWIFSA-N |
| XLogP | 2.08 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|