C15H9N3O5S2 — CID 20832194
5-[[(5E)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 20832194) has the molecular formula C15H9N3O5S2 and a molecular weight of 375.39 g/mol. Its IUPAC name is 5-[[(5E)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[(5E)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 20832194 |
| Molecular Formula | C15H9N3O5S2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 5-[[(5E)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=CN2C(=O)/C(=C\c3ccc(O)cc3)SC2=S)C(=O)N1 |
| InChI | InChI=1S/C15H9N3O5S2/c19-8-3-1-7(2-4-8)5-10-13(22)18(15(24)25-10)6-9-11(20)16-14(23)17-12(9)21/h1-6,19H,(H2,16,17,20,21,23)/b10-5+ |
| InChIKey | ROSDZFDGNGNCGS-BJMVGYQFSA-N |
| XLogP | 0.84 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|