C15H8N4O6S2 — CID 45046534
5-[[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 45046534) has the molecular formula C15H8N4O6S2 and a molecular weight of 404.39 g/mol. Its IUPAC name is 5-[[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 45046534 |
| Molecular Formula | C15H8N4O6S2 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | 5-[[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=CN2C(=O)/C(=C\c3ccc([N+](=O)[O-])cc3)SC2=S)C(=O)N1 |
| InChI | InChI=1S/C15H8N4O6S2/c20-11-9(12(21)17-14(23)16-11)6-18-13(22)10(27-15(18)26)5-7-1-3-8(4-2-7)19(24)25/h1-6H,(H2,16,17,20,21,23)/b10-5+ |
| InChIKey | PCGQGIYCBXXXPJ-BJMVGYQFSA-N |
| XLogP | 1.05 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|