C20H10N2O6S2 — CID 50987675
(3E)-3-[[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]chromene-2,4-dione (PubChem CID 50987675) has the molecular formula C20H10N2O6S2 and a molecular weight of 438.44 g/mol. Its IUPAC name is (3E)-3-[[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]chromene-2,4-dione.
| Compound Name | (3E)-3-[[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]chromene-2,4-dione |
|---|---|
| PubChem CID | 50987675 |
| Molecular Formula | C20H10N2O6S2 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | (3E)-3-[[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]chromene-2,4-dione |
| SMILES | O=C1Oc2ccccc2C(=O)/C1=C\N1C(=O)/C(=C\c2ccc([N+](=O)[O-])cc2)SC1=S |
| InChI | InChI=1S/C20H10N2O6S2/c23-17-13-3-1-2-4-15(13)28-19(25)14(17)10-21-18(24)16(30-20(21)29)9-11-5-7-12(8-6-11)22(26)27/h1-10H/b14-10+,16-9+ |
| InChIKey | DJFUFNNDOAUACG-KWHSPZGRSA-N |
| XLogP | 3.48 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|