C21H11NO6S2 — CID 5467745
(3Z)-3-[[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]chromene-2,4-dione (PubChem CID 5467745) has the molecular formula C21H11NO6S2 and a molecular weight of 437.45 g/mol. Its IUPAC name is (3Z)-3-[[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]chromene-2,4-dione.
| Compound Name | (3Z)-3-[[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]chromene-2,4-dione |
|---|---|
| PubChem CID | 5467745 |
| Molecular Formula | C21H11NO6S2 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | (3Z)-3-[[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylidene]chromene-2,4-dione |
| SMILES | O=C1Oc2ccccc2C(=O)/C1=C/N1C(=O)C(=Cc2ccc3c(c2)OCO3)SC1=S |
| InChI | InChI=1S/C21H11NO6S2/c23-18-12-3-1-2-4-14(12)28-20(25)13(18)9-22-19(24)17(30-21(22)29)8-11-5-6-15-16(7-11)27-10-26-15/h1-9H,10H2/b13-9-,17-8? |
| InChIKey | SMWXVSXJSFPHNB-VTPQVJFRSA-N |
| XLogP | 3.30 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|