C13H15N2O9S2+ — CID 54678456
(E)-1-[3,4-bis(methylsulfonyloxy)phenyl]-3-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium (PubChem CID 54678456) has the molecular formula C13H15N2O9S2+ and a molecular weight of 407.40 g/mol. Its IUPAC name is (E)-1-[3,4-bis(methylsulfonyloxy)phenyl]-3-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium.
| Compound Name | (E)-1-[3,4-bis(methylsulfonyloxy)phenyl]-3-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium |
|---|---|
| PubChem CID | 54678456 |
| Molecular Formula | C13H15N2O9S2+ |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | (E)-1-[3,4-bis(methylsulfonyloxy)phenyl]-3-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium |
| SMILES | CCOC(=O)/C([N+]#N)=C(\O)c1ccc(OS(C)(=O)=O)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H14N2O9S2/c1-4-22-13(17)11(15-14)12(16)8-5-6-9(23-25(2,18)19)10(7-8)24-26(3,20)21/h5-7H,4H2,1-3H3/p+1 |
| InChIKey | JPPXOYINQLCFTH-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 161.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|