C26H20F3NO4S — CID 54680218
N-[2,2-bis(4-methoxyphenyl)ethenyl]-3-hydroxy-5-(trifluoromethyl)-1-benzothiophene-2-carboxamide (PubChem CID 54680218) has the molecular formula C26H20F3NO4S and a molecular weight of 499.51 g/mol. Its IUPAC name is N-[2,2-bis(4-methoxyphenyl)ethenyl]-3-hydroxy-5-(trifluoromethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2,2-bis(4-methoxyphenyl)ethenyl]-3-hydroxy-5-(trifluoromethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 54680218 |
| Molecular Formula | C26H20F3NO4S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | N-[2,2-bis(4-methoxyphenyl)ethenyl]-3-hydroxy-5-(trifluoromethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(C(=CNC(=O)c2sc3ccc(C(F)(F)F)cc3c2O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H20F3NO4S/c1-33-18-8-3-15(4-9-18)21(16-5-10-19(34-2)11-6-16)14-30-25(32)24-23(31)20-13-17(26(27,28)29)7-12-22(20)35-24/h3-14,31H,1-2H3,(H,30,32) |
| InChIKey | UXUQTBKQKIREAG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|