C19H13ClN2O3 — CID 54683575
3-[(3-chlorophenyl)methyl]-5-hydroxypyrazino[1,2-a]quinoline-4,6-dione (PubChem CID 54683575) has the molecular formula C19H13ClN2O3 and a molecular weight of 352.78 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methyl]-5-hydroxypyrazino[1,2-a]quinoline-4,6-dione.
| Compound Name | 3-[(3-chlorophenyl)methyl]-5-hydroxypyrazino[1,2-a]quinoline-4,6-dione |
|---|---|
| PubChem CID | 54683575 |
| Molecular Formula | C19H13ClN2O3 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 3-[(3-chlorophenyl)methyl]-5-hydroxypyrazino[1,2-a]quinoline-4,6-dione |
| SMILES | O=c1c(O)c2c(=O)n(Cc3cccc(Cl)c3)ccn2c2ccccc12 |
| InChI | InChI=1S/C19H13ClN2O3/c20-13-5-3-4-12(10-13)11-21-8-9-22-15-7-2-1-6-14(15)17(23)18(24)16(22)19(21)25/h1-10,24H,11H2 |
| InChIKey | KRDNEXQRIXYCRU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|