C15H12N2O4 — CID 54683719
2-benzyl-8,9-dihydroxypyrido[1,2-a]pyrazine-1,6-dione (PubChem CID 54683719) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-benzyl-8,9-dihydroxypyrido[1,2-a]pyrazine-1,6-dione.
| Compound Name | 2-benzyl-8,9-dihydroxypyrido[1,2-a]pyrazine-1,6-dione |
|---|---|
| PubChem CID | 54683719 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-benzyl-8,9-dihydroxypyrido[1,2-a]pyrazine-1,6-dione |
| SMILES | O=c1c2c(O)c(O)cc(=O)n2ccn1Cc1ccccc1 |
| InChI | InChI=1S/C15H12N2O4/c18-11-8-12(19)17-7-6-16(15(21)13(17)14(11)20)9-10-4-2-1-3-5-10/h1-8,18,20H,9H2 |
| InChIKey | FDDQPKPESBZBOL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 83.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |