C19H16N2O3 — CID 67104917
1-benzyl-4-hydroxy-6-oxo-N-phenylpyridine-3-carboxamide (PubChem CID 67104917) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-benzyl-4-hydroxy-6-oxo-N-phenylpyridine-3-carboxamide.
| Compound Name | 1-benzyl-4-hydroxy-6-oxo-N-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 67104917 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 1-benzyl-4-hydroxy-6-oxo-N-phenylpyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cn(Cc2ccccc2)c(=O)cc1O |
| InChI | InChI=1S/C19H16N2O3/c22-17-11-18(23)21(12-14-7-3-1-4-8-14)13-16(17)19(24)20-15-9-5-2-6-10-15/h1-11,13,22H,12H2,(H,20,24) |
| InChIKey | YMNWWLWPWLSVRM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |