C25H29N3O2 — CID 123215323
2-(7-amino-7-oxoheptyl)-1-benzyl-N-phenylpyrrole-3-carboxamide (PubChem CID 123215323) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-(7-amino-7-oxoheptyl)-1-benzyl-N-phenylpyrrole-3-carboxamide.
| Compound Name | 2-(7-amino-7-oxoheptyl)-1-benzyl-N-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 123215323 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-(7-amino-7-oxoheptyl)-1-benzyl-N-phenylpyrrole-3-carboxamide |
| SMILES | NC(=O)CCCCCCc1c(C(=O)Nc2ccccc2)ccn1Cc1ccccc1 |
| InChI | InChI=1S/C25H29N3O2/c26-24(29)16-10-2-1-9-15-23-22(25(30)27-21-13-7-4-8-14-21)17-18-28(23)19-20-11-5-3-6-12-20/h3-8,11-14,17-18H,1-2,9-10,15-16,19H2,(H2,26,29)(H,27,30) |
| InChIKey | DKGCGEDYFOLSIO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|