C23H31N3O2 — CID 11361035
4-[phenylcarbamoyl(6-phenylhexyl)amino]butanamide (PubChem CID 11361035) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-[phenylcarbamoyl(6-phenylhexyl)amino]butanamide.
| Compound Name | 4-[phenylcarbamoyl(6-phenylhexyl)amino]butanamide |
|---|---|
| PubChem CID | 11361035 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 4-[phenylcarbamoyl(6-phenylhexyl)amino]butanamide |
| SMILES | NC(=O)CCCN(CCCCCCc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H31N3O2/c24-22(27)17-11-19-26(23(28)25-21-15-8-4-9-16-21)18-10-2-1-5-12-20-13-6-3-7-14-20/h3-4,6-9,13-16H,1-2,5,10-12,17-19H2,(H2,24,27)(H,25,28) |
| InChIKey | XZNVGGUEWAQZAP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|