C23H26N4O4S — CID 129085013
N'-[4-(4-benzyl-3,5-dioxo-1,2,4-thiadiazolidin-2-yl)phenyl]octanediamide (PubChem CID 129085013) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is N'-[4-(4-benzyl-3,5-dioxo-1,2,4-thiadiazolidin-2-yl)phenyl]octanediamide.
| Compound Name | N'-[4-(4-benzyl-3,5-dioxo-1,2,4-thiadiazolidin-2-yl)phenyl]octanediamide |
|---|---|
| PubChem CID | 129085013 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N'-[4-(4-benzyl-3,5-dioxo-1,2,4-thiadiazolidin-2-yl)phenyl]octanediamide |
| SMILES | NC(=O)CCCCCCC(=O)Nc1ccc(-n2sc(=O)n(Cc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C23H26N4O4S/c24-20(28)10-6-1-2-7-11-21(29)25-18-12-14-19(15-13-18)27-22(30)26(23(31)32-27)16-17-8-4-3-5-9-17/h3-5,8-9,12-15H,1-2,6-7,10-11,16H2,(H2,24,28)(H,25,29) |
| InChIKey | BGLLWVQGLCZVJF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|