C17H26O6 — CID 54685136
6-[(E,2S,5S,6S)-2,5-dihydroxy-4,6-dimethyloct-3-en-2-yl]-4-hydroxy-5-(hydroxymethyl)-3-methylpyran-2-one (PubChem CID 54685136) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is 6-[(E,2S,5S,6S)-2,5-dihydroxy-4,6-dimethyloct-3-en-2-yl]-4-hydroxy-5-(hydroxymethyl)-3-methylpyran-2-one.
| Compound Name | 6-[(E,2S,5S,6S)-2,5-dihydroxy-4,6-dimethyloct-3-en-2-yl]-4-hydroxy-5-(hydroxymethyl)-3-methylpyran-2-one |
|---|---|
| PubChem CID | 54685136 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 6-[(E,2S,5S,6S)-2,5-dihydroxy-4,6-dimethyloct-3-en-2-yl]-4-hydroxy-5-(hydroxymethyl)-3-methylpyran-2-one |
| SMILES | CC[C@H](C)[C@H](O)/C(C)=C/[C@](C)(O)c1oc(=O)c(C)c(O)c1CO |
| InChI | InChI=1S/C17H26O6/c1-6-9(2)13(19)10(3)7-17(5,22)15-12(8-18)14(20)11(4)16(21)23-15/h7,9,13,18-20,22H,6,8H2,1-5H3/b10-7+/t9-,13-,17-/m0/s1 |
| InChIKey | HVGOTNBMFWSXLX-ALMLBBPJSA-N |
| XLogP | 1.71 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|