C22H16N2O2 — CID 54690659
4-hydroxy-1,3-diphenyl-6-pyridin-3-ylpyridin-2-one (PubChem CID 54690659) has the molecular formula C22H16N2O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-hydroxy-1,3-diphenyl-6-pyridin-3-ylpyridin-2-one.
| Compound Name | 4-hydroxy-1,3-diphenyl-6-pyridin-3-ylpyridin-2-one |
|---|---|
| PubChem CID | 54690659 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-hydroxy-1,3-diphenyl-6-pyridin-3-ylpyridin-2-one |
| SMILES | O=c1c(-c2ccccc2)c(O)cc(-c2cccnc2)n1-c1ccccc1 |
| InChI | InChI=1S/C22H16N2O2/c25-20-14-19(17-10-7-13-23-15-17)24(18-11-5-2-6-12-18)22(26)21(20)16-8-3-1-4-9-16/h1-15,25H |
| InChIKey | RKYMUVWHGRSRQJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |