About dimethyl 5-hydroxy-2,7-dimethyl-6-oxooxepine-3,4-dicarboxylate
dimethyl 5-hydroxy-2,7-dimethyl-6-oxooxepine-3,4-dicarboxylate (PubChem CID 54690705) has the molecular formula C12H14O7
and a molecular weight of 270.24 g/mol. Its IUPAC name is dimethyl 5-hydroxy-2,7-dimethyl-6-oxooxepine-3,4-dicarboxylate.
Analyze dimethyl 5-hydroxy-2,7-dimethyl-6-oxooxepine-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 5-hydroxy-2,7-dimethyl-6-oxooxepine-3,4-dicarboxylate?
The IUPAC name of dimethyl 5-hydroxy-2,7-dimethyl-6-oxooxepine-3,4-dicarboxylate (CID 54690705) is dimethyl 5-hydroxy-2,7-dimethyl-6-oxooxepine-3,4-dicarboxylate.
What is the SMILES notation for dimethyl 5-hydroxy-2,7-dimethyl-6-oxooxepine-3,4-dicarboxylate?
The canonical SMILES for dimethyl 5-hydroxy-2,7-dimethyl-6-oxooxepine-3,4-dicarboxylate is COC(=O)C1=C(C)OC(C)C(=O)C(O)=C1C(=O)OC.
What is the InChIKey of dimethyl 5-hydroxy-2,7-dimethyl-6-oxooxepine-3,4-dicarboxylate?
The InChIKey is OPAGOYALZIXUPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O7/c1-5-7(11(15)17-3)8(12(16)18-4)10(14)9(13)6(2)19-5/h6,14H,1-4H3.
What are the key properties of dimethyl 5-hydroxy-2,7-dimethyl-6-oxooxepine-3,4-dicarboxylate?
dimethyl 5-hydroxy-2,7-dimethyl-6-oxooxepine-3,4-dicarboxylate has a molecular weight of 270.24 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 5-hydroxy-2,7-dimethyl-6-oxooxepine-3,4-dicarboxylate is sourced from PubChem (CID 54690705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).