C17H28O3 — CID 54690712
3,6-dihexyl-4-hydroxypyran-2-one (PubChem CID 54690712) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 3,6-dihexyl-4-hydroxypyran-2-one.
| Compound Name | 3,6-dihexyl-4-hydroxypyran-2-one |
|---|---|
| PubChem CID | 54690712 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 3,6-dihexyl-4-hydroxypyran-2-one |
| SMILES | CCCCCCc1cc(O)c(CCCCCC)c(=O)o1 |
| InChI | InChI=1S/C17H28O3/c1-3-5-7-9-11-14-13-16(18)15(17(19)20-14)12-10-8-6-4-2/h13,18H,3-12H2,1-2H3 |
| InChIKey | ZXPFDGSMLJREOU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|