C26H30N2O5S — CID 54691022
N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]pyridine-2-sulfonamide (PubChem CID 54691022) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]pyridine-2-sulfonamide.
| Compound Name | N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 54691022 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]pyridine-2-sulfonamide |
| SMILES | CCCC(c1cccc(NS(=O)(=O)c2ccccn2)c1)c1c(O)c2c(oc1=O)CCCCCC2 |
| InChI | InChI=1S/C26H30N2O5S/c1-2-10-20(24-25(29)21-13-5-3-4-6-14-22(21)33-26(24)30)18-11-9-12-19(17-18)28-34(31,32)23-15-7-8-16-27-23/h7-9,11-12,15-17,20,28-29H,2-6,10,13-14H2,1H3 |
| InChIKey | NDJZQIFDZSXSGR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |