C19H27NO3 — CID 54691208
3-[1-(3-aminophenyl)propyl]-4-hydroxy-5,5-dipropylfuran-2-one (PubChem CID 54691208) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-[1-(3-aminophenyl)propyl]-4-hydroxy-5,5-dipropylfuran-2-one.
| Compound Name | 3-[1-(3-aminophenyl)propyl]-4-hydroxy-5,5-dipropylfuran-2-one |
|---|---|
| PubChem CID | 54691208 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 3-[1-(3-aminophenyl)propyl]-4-hydroxy-5,5-dipropylfuran-2-one |
| SMILES | CCCC1(CCC)OC(=O)C(C(CC)c2cccc(N)c2)=C1O |
| InChI | InChI=1S/C19H27NO3/c1-4-10-19(11-5-2)17(21)16(18(22)23-19)15(6-3)13-8-7-9-14(20)12-13/h7-9,12,15,21H,4-6,10-11,20H2,1-3H3 |
| InChIKey | KJEGYIBYRBJGDT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|