C24H28FNO3 — CID 59928575
5-[1-(3-aminophenyl)ethyl]-2-[2-(4-fluorophenyl)ethyl]-4-hydroxy-2-propyl-3H-pyran-6-one (PubChem CID 59928575) has the molecular formula C24H28FNO3 and a molecular weight of 397.49 g/mol. Its IUPAC name is 5-[1-(3-aminophenyl)ethyl]-2-[2-(4-fluorophenyl)ethyl]-4-hydroxy-2-propyl-3H-pyran-6-one.
| Compound Name | 5-[1-(3-aminophenyl)ethyl]-2-[2-(4-fluorophenyl)ethyl]-4-hydroxy-2-propyl-3H-pyran-6-one |
|---|---|
| PubChem CID | 59928575 |
| Molecular Formula | C24H28FNO3 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 5-[1-(3-aminophenyl)ethyl]-2-[2-(4-fluorophenyl)ethyl]-4-hydroxy-2-propyl-3H-pyran-6-one |
| SMILES | CCCC1(CCc2ccc(F)cc2)CC(O)=C(C(C)c2cccc(N)c2)C(=O)O1 |
| InChI | InChI=1S/C24H28FNO3/c1-3-12-24(13-11-17-7-9-19(25)10-8-17)15-21(27)22(23(28)29-24)16(2)18-5-4-6-20(26)14-18/h4-10,14,16,27H,3,11-13,15,26H2,1-2H3 |
| InChIKey | RJFIYPZXFBDDJY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|