C6H7NO4 — CID 54691718
4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxylic acid (PubChem CID 54691718) has the molecular formula C6H7NO4 and a molecular weight of 157.12 g/mol. Its IUPAC name is 4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxylic acid.
| Compound Name | 4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 54691718 |
| Molecular Formula | C6H7NO4 |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxylic acid |
| SMILES | CN1CC(C(=O)O)=C(O)C1=O |
| InChI | InChI=1S/C6H7NO4/c1-7-2-3(6(10)11)4(8)5(7)9/h8H,2H2,1H3,(H,10,11) |
| InChIKey | UXYJMWIHDZCOHX-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |