C7H9NO4 — CID 54691762
1-ethyl-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid (PubChem CID 54691762) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is 1-ethyl-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid.
| Compound Name | 1-ethyl-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 54691762 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 1-ethyl-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid |
| SMILES | CCN1CC(C(=O)O)=C(O)C1=O |
| InChI | InChI=1S/C7H9NO4/c1-2-8-3-4(7(11)12)5(9)6(8)10/h9H,2-3H2,1H3,(H,11,12) |
| InChIKey | FPBKOMYGDSCEFD-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |