C31H32N2O9 — CID 54691946
4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[(E)-3-(2-hydroxy-3-methoxyphenyl)prop-1-enyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54691946) has the molecular formula C31H32N2O9 and a molecular weight of 576.60 g/mol. Its IUPAC name is 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[(E)-3-(2-hydroxy-3-methoxyphenyl)prop-1-enyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[(E)-3-(2-hydroxy-3-methoxyphenyl)prop-1-enyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54691946 |
| Molecular Formula | C31H32N2O9 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[(E)-3-(2-hydroxy-3-methoxyphenyl)prop-1-enyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COc1cccc(C/C=C/c2ccc(O)c3c2CC2CC4C(N(C)C)C(=O)C(C(N)=O)=C(O)C4(O)C(=O)C2=C3O)c1O |
| InChI | InChI=1S/C31H32N2O9/c1-33(2)24-18-13-16-12-17-14(6-4-7-15-8-5-9-20(42-3)25(15)35)10-11-19(34)22(17)26(36)21(16)28(38)31(18,41)29(39)23(27(24)37)30(32)40/h4-6,8-11,16,18,24,34-36,39,41H,7,12-13H2,1-3H3,(H2,32,40)/b6-4+ |
| InChIKey | MDNBQYGIHHAULL-GQCTYLIASA-N |
| XLogP | 1.93 |
| TPSA | 190.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|