C29H27BrN2O7 — CID 58461272
(4R,4aR,5aS,12aS)-7-[(E)-2-(4-bromophenyl)ethenyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58461272) has the molecular formula C29H27BrN2O7 and a molecular weight of 595.45 g/mol. Its IUPAC name is (4R,4aR,5aS,12aS)-7-[(E)-2-(4-bromophenyl)ethenyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aS)-7-[(E)-2-(4-bromophenyl)ethenyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58461272 |
| Molecular Formula | C29H27BrN2O7 |
| Molecular Weight | 595.45 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | (4R,4aR,5aS,12aS)-7-[(E)-2-(4-bromophenyl)ethenyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)=C(O)[C@]2(O)C(=O)C3=C(O)c4c(O)ccc(/C=C/c5ccc(Br)cc5)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C29H27BrN2O7/c1-32(2)23-18-12-15-11-17-14(6-3-13-4-8-16(30)9-5-13)7-10-19(33)21(17)24(34)20(15)26(36)29(18,39)27(37)22(25(23)35)28(31)38/h3-10,15,18,23,33-34,37,39H,11-12H2,1-2H3,(H2,31,38)/b6-3+/t15-,18-,23-,29-/m1/s1 |
| InChIKey | SMJDHYKRKOXLKL-QVTNCPQJSA-N |
| XLogP | 2.90 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|